RefMet Compound Details
MW structure | 34361 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Cholesterol | |
Systematic name | cholest-5-en-3beta-ol | |
SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 27:1;O | View other entries in RefMet with this sum composition |
Exact mass | 386.354865 (neutral) |
Table of KEGG reactions in human pathways involving Cholesterol
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R07218 | Cholesterol + Reduced acceptor + Oxygen <=> 25-Hydroxycholesterol + Acceptor + H2O | cholesterol,hydrogen-donor:oxygen oxidoreductase (25-hydroxylating) |
R07207 | Cholesterol + [Reduced NADPH---hemoprotein reductase] + Oxygen <=> Cerebrosterol + [Oxidized NADPH---hemoprotein reductase] + H2O | cholesterol,NADPH-hemoprotein reductase:oxygen oxidoreductase (24-hydroxylating) |
R02723 | Cholesterol + Oxygen + 2 Reduced adrenal ferredoxin + 2 H+ <=> 22(R)-Hydroxycholesterol + H2O + 2 Oxidized adrenal ferredoxin | Cholesterol + Oxygen + 2 Reduced adrenal ferredoxin + 2 H+ <=> 22(R)-Hydroxycholesterol + H2O + 2 Oxidized adrenal ferredoxin |
R01461 | Acyl-CoA + Cholesterol <=> CoA + Cholesterol ester | Acyl-CoA:cholesterol O-acyltransferase |
R08941 | Cholesterol + Sulfate <=> Cholesterol sulfate + H2O | Cholesterol-sulfate sulfohydrolase |
R01456 | Cholesterol + NADP+ <=> 7-Dehydrocholesterol + NADPH + H+ | cholesterol:NADP+ delta7-oxidoreductase |
R08977 | Cholesterol + 3'-Phosphoadenylyl sulfate <=> Cholesterol sulfate + Adenosine 3',5'-bisphosphate | 3'-phosphoadenylyl-sulfate:cholesterol sulfotransferase |
R01454 | Cholesterol + Oxygen + 2 H+ + 2 Reduced adrenal ferredoxin <=> 20alpha-Hydroxycholesterol + H2O + 2 Oxidized adrenal ferredoxin | Cholesterol:oxygen oxidoreductase (side-chain-cleaving) |
R01462 | Cholesterol ester + H2O <=> Cholesterol + Fatty acid | cholesterol ester acylhydrolase |
R01463 | Cholesterol + Oxygen + [Reduced NADPH---hemoprotein reductase] <=> 7alpha-Hydroxycholesterol + [Oxidized NADPH---hemoprotein reductase] + H2O | cholesterol,NADPH-hemoprotein reductase:oxygen oxidoreductase (7alpha-hydroxylating) |
R08505 | Cholesterol + Oxygen + 2 H+ + 2 Reduced adrenal ferredoxin <=> Cholest-5-ene-3beta,26-diol + H2O + 2 Oxidized adrenal ferredoxin | cholesterol 26-hydroxylase |
R01451 | Cholesterol + NAD+ <=> 7-Dehydrocholesterol + NADH + H+ | Cholesterol:NAD+ delta7-oxidoreductase |
R01457 | Cholesterol + NADP+ <=> Desmosterol + H+ + NADPH | cholesterol:NADP+ Delta24-oxidoreductase |
Table of KEGG human pathways containing Cholesterol
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00100 | Steroid biosynthesis | 5 |
hsa00120 | Primary bile acid biosynthesis | 4 |
hsa00140 | Steroid hormone biosynthesis | 4 |
hsa01100 | Metabolic pathways | 2 |