RefMet Compound Details
MW structure | 42914 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Carnitine | |
Systematic name | 3-hydroxy-4-(trimethylammonio)butanoate | |
SMILES | C[N+](C)(C)C[C@@H](O)CC([O-])=O | |
Exact mass | 161.105194 (neutral) |
Table of KEGG reactions in human pathways involving Carnitine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02397 | 4-Trimethylammoniobutanoate + 2-Oxoglutarate + Oxygen <=> Carnitine + Succinate + CO2 | 4-Trimethylammoniobutanoate,2-oxoglutarate:oxygen oxidoreductase (3-hydroxylating) |
Table of KEGG human pathways containing Carnitine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00310 | Lysine degradation | 1 |