RefMet Compound Details
MW structure | 34760 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Campesterol | |
Systematic name | campest-5-en-3beta-ol | |
SMILES | CC(C)[C@H](C)CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 28:1;O | View other entries in RefMet with this sum composition |
Exact mass | 400.370515 (neutral) |
Table of KEGG reactions in human pathways involving Campesterol
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R07493 | 24-Methylenecholesterol + NADPH + H+ <=> Campesterol + NADP+ | 24-Methylenecholesterol + NADPH + H+ <=> Campesterol + NADP+ |
Table of KEGG human pathways containing Campesterol
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00100 | Steroid biosynthesis | 1 |