RefMet Compound Details

MW structure37072 (View MW Metabolite Database details)
RefMet nameCMP
Systematic name{[(2R,3S,4R,5R)-5-(4-amino-2-oxo-1,2-dihydropyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}phosphonic acid
SMILESc1cn([C@H]2[C@@H]([C@@H]([C@@H](COP(=O)(O)O)O2)O)O)c(=O)nc1N   Run Tanimoto similarity search (with similarity coefficient >=0.6)
Exact mass323.051855 (neutral)
Calculate m/z:   
View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC9H14N3O8PView other entries in RefMet with this formula
InChIInChI=1S/C9H14N3O8P/c10-5-1-2-12(9(15)11-5)8-7(14)6(13)4(20-8)3-19-21(16,17)18/h1-2,4,6-8,13-14H,3H2,(H2,10,11,15)(H2,16,17,18)/t4
-,6-,7-,8-/m1/s1
InChIKeyIERHLVCPSMICTF-XVFCMESISA-NView other enantiomers/diastereomers of this metabolite in RefMet
Super ClassNucleic acids
Main ClassPyrimidines
Sub ClassPyrimidine rNMP
Pubchem CID6131
Annotation level1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)

Table of KEGG reactions in human pathways involving CMP

Rxn IDKEGG ReactionEnzyme
R01548 dATP + Cytidine <=> dADP + CMPdATP:cytidine 5'-phosphotransferase
R00512 ATP + CMP <=> ADP + CDPATP:CMP phosphotransferase
R00962 ITP + Cytidine <=> IDP + CMPITP:cytidine 5'-phosphotransferase
R02372 dUTP + Cytidine <=> dUDP + CMPdUTP:cytidine 5'-phosphotransferase
R00517 GTP + Cytidine <=> GDP + CMPGTP:cytidine 5'-phosphotransferase
R02096 dTTP + Cytidine <=> dTDP + CMPdTTP:cytidine 5'-phosphotransferase
R00513 ATP + Cytidine <=> ADP + CMPATP:cytidine 5'-phosphotransferase
R00515 CTP + H2O <=> CMP + DiphosphateCTP diphosphohydrolase (diphosphate-forming)
R02091 dGTP + Cytidine <=> dGDP + CMPdGTP:cytidine 5'-phosphotransferase
R00511 CMP + H2O <=> Cytidine + Orthophosphatecytidine-5'-monophosphate phosphohydrolase
R00514 CDP + H2O <=> CMP + OrthophosphateCDP phosphohydrolase
R00516 UTP + Cytidine <=> UDP + CMPUTP:cytidine 5'-phosphotransferase
R02371 dCTP + Cytidine <=> dCDP + CMPdCTP:cytidine 5'-phosphotransferase

Table of KEGG human pathways containing CMP

Pathway IDHuman Pathway# of reactions
hsa00240 Pyrimidine metabolism 6
hsa01100 Metabolic pathways 2
hsa01232 Nucleotide metabolism 2
  logo