RefMet Compound Details
MW structure | 37872 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | CDP-Ethanolamine | |
Systematic name | [({[(2R,3S,4R,5R)-5-(4-amino-2-oxo-1,2-dihydropyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy](2-aminoethoxy)phosphinic acid | |
SMILES | c1cn([C@H]2[C@@H]([C@@H]([C@@H](COP(=O)(O)OP(=O)(O)OCCN)O2)O)O)c(=O)nc1N Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 446.060387 (neutral) |
Table of KEGG reactions in human pathways involving CDP-Ethanolamine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02038 | CTP + Ethanolamine phosphate <=> Diphosphate + CDP-ethanolamine | CTP:ethanolamine-phosphate cytidylyltransferase |
Table of KEGG human pathways containing CDP-Ethanolamine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00564 | Glycerophospholipid metabolism | 2 |