RefMet Compound Details
MW structure | 37047 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Bilirubin | |
Systematic name | 3-(2-{[3-(2-carboxyethyl)-5-{[(2Z)-4-ethenyl-3-methyl-5-oxo-2,5-dihydro-1H-pyrrol-2-ylidene]methyl}-4-methyl-1H-pyrrol-2-yl]methyl}-5-{[(2Z)-3-ethenyl-4-methyl-5-oxo-2,5-dihydro-1H-pyrrol-2-ylidene]methyl}-4-methyl-1H-pyrrol-3-yl)propanoic acid | |
SMILES | C=CC1=C(C)/C(=C/c2[nH]c(Cc3[nH]c(/C=C4\NC(=O)C(C)=C4C=C)c(C)c3CCC(=O)O)c(CCC(=O)O)c2C)NC1=O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 584.263486 (neutral) |
Table of KEGG reactions in human pathways involving Bilirubin
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02391 | Bilirubin + NAD+ <=> Biliverdin + NADH + H+ | Bilirubin:NAD+ oxidoreductase |
R02393 | Bilirubin + NADP+ <=> Biliverdin + NADPH + H+ | Bilirubin:NADP+ oxidoreductase |
R12481 | Bilirubin + Oxidised coenzyme F420-(gamma-Glu)n <=> Biliverdin + Reduced coenzyme F420-(gamma-Glu)n | Bilirubin + Oxidised coenzyme F420-(gamma-Glu)n <=> Biliverdin + Reduced coenzyme F420-(gamma-Glu)n |
R02389 | 2 UDP-glucuronate + Bilirubin <=> 2 UDP + Bilirubin beta-diglucuronide | UDPglucuronate beta-D-glucuronosyltransferase(acceptor-unspecific) |
Table of KEGG human pathways containing Bilirubin
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa01100 | Metabolic pathways | 3 |
hsa00860 | Porphyrin metabolism | 2 |
hsa00860 | Porphyrin and chlorophyll metabolism | 1 |