RefMet Compound Details

MW structure37114 (View MW Metabolite Database details)
RefMet nameAsparagine
Systematic name(2S)-2-amino-3-carbamoylpropanoic acid
SMILESC([C@@H](C(=O)O)N)C(=O)N   Run Tanimoto similarity search (with similarity coefficient >=0.6)
Exact mass132.053493 (neutral)
Calculate m/z:   
View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC4H8N2O3View other entries in RefMet with this formula
InChIInChI=1S/C4H8N2O3/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H2,6,7)(H,8,9)/t2-/m0/s1
InChIKeyDCXYFEDJOCDNAF-REOHCLBHSA-NView other enantiomers/diastereomers of this metabolite in RefMet
Super ClassOrganic acids
Main ClassAmino acids and peptides
Sub ClassAmino acids
Pubchem CID6267
Annotation level1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)

Table of KEGG reactions in human pathways involving Asparagine

Rxn IDKEGG ReactionEnzyme
R00483 ATP + L-Aspartate + Ammonia <=> AMP + Diphosphate + L-AsparagineL-aspartate:ammonia ligase (AMP-forming)
R00485 L-Asparagine + H2O <=> L-Aspartate + AmmoniaL-asparagine amidohydrolase
R00578 ATP + L-Aspartate + L-Glutamine + H2O <=> AMP + Diphosphate + L-Asparagine + L-GlutamateL-aspartate:L-glutamine amido-ligase (AMP-forming)
R03648 ATP + L-Asparagine + tRNA(Asn) <=> AMP + Diphosphate + L-Asparaginyl-tRNA(Asn)L-Asparagine:tRNA(Asn) ligase (AMP-forming)

Table of KEGG human pathways containing Asparagine

Pathway IDHuman Pathway# of reactions
hsa00250 Alanine, aspartate and glutamate metabolism 2
hsa00970 Aminoacyl-tRNA biosynthesis 1
hsa01100 Metabolic pathways 1
hsa01230 Biosynthesis of amino acids 1
  logo