RefMet Compound Details

MW structure37289 (View MW Metabolite Database details)
RefMet nameArginine
Systematic name(2S)-2-amino-5-[(diaminomethylidene)amino]pentanoic acid
SMILESNC(=N)NCCC[C@@H](N)C(O)=O
Exact mass174.111676 (neutral)
Calculate m/z:   
View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC6H14N4O2View other entries in RefMet with this formula
InChIInChI=1S/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t4-/m0/s1
InChIKeyODKSFYDXXFIFQN-BYPYZUCNSA-NView other enantiomers/diastereomers of this metabolite in RefMet
Super ClassOrganic acids
Main ClassAmino acids and peptides
Sub ClassAmino acids
Pubchem CID6322
Annotation level1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)
Human quantitationView measurements in targeted assays on human samples

Table of KEGG reactions in human pathways involving Arginine

Rxn IDKEGG ReactionEnzyme
R00565 L-Arginine + Glycine <=> L-Ornithine + GuanidinoacetateL-Arginine:glycine amidinotransferase
R01086 N-(L-Arginino)succinate <=> Fumarate + L-Arginine2-(Nomega-L-arginino)succinate arginine-lyase (fumarate-forming)
R11711 2 L-Arginine + 3 Reduced flavodoxin + 4 Oxygen <=> 2 L-Citrulline + 2 Nitric oxide + 3 Oxidized flavodoxin + 4 H2OL-arginine,reduced-flavodoxin:oxygen oxidoreductase (nitric-oxide-forming)
R00566 L-Arginine <=> Agmatine + CO2L-arginine carboxy-lyase (agmatine-forming)
R00557 2 L-Arginine + 4 Oxygen + 3 NADPH + 3 H+ <=> 2 Nitric oxide + 2 L-Citrulline + 3 NADP+ + 4 H2OL-arginine,NADPH:oxygen oxidoreductase (nitric-oxide-forming)
R11033 L-Arginine <=> N(omega)-HydroxyarginineL-Arginine <=> N(omega)-Hydroxyarginine
R00551 L-Arginine + H2O <=> L-Ornithine + UreaL-Arginine amidinohydrolase
R00558 L-Arginine + Oxygen + NADPH + H+ <=> N(omega)-Hydroxyarginine + NADP+ + H2OL-arginine,NADPH:oxygen oxidoreductase (N-(omega)-hydroxyarginine-forming)
R03646 ATP + L-Arginine + tRNA(Arg) <=> AMP + Diphosphate + L-Arginyl-tRNA(Arg)L-Arginine:tRNA(Arg) ligase (AMP-forming)
R00552 L-Arginine + H2O <=> L-Citrulline + AmmoniaL-Arginine iminohydrolase
R11712 2 L-Arginine + 2 Reduced flavodoxin + 2 Oxygen <=> 2 N(omega)-Hydroxyarginine + 2 Oxidized flavodoxin + 2 H2O2 L-Arginine + 2 Reduced flavodoxin + 2 Oxygen <=> 2 N(omega)-Hydroxyarginine + 2 Oxidized flavodoxin + 2 H2O

Table of KEGG human pathways containing Arginine

Pathway IDHuman Pathway# of reactions
hsa00330 Arginine and proline metabolism 4
hsa01100 Metabolic pathways 4
hsa00220 Arginine biosynthesis 3
hsa01230 Biosynthesis of amino acids 2
hsa00260 Glycine, serine and threonine metabolism 1
hsa00970 Aminoacyl-tRNA biosynthesis 1
hsa00250 Alanine, aspartate and glutamate metabolism 1
  logo