RefMet Compound Details
MW structure | 39031 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Adrenosterone | |
Systematic name | (1S,2R,10S,11S,15S)-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadec-6-ene-5,14,17-trione | |
SMILES | C[C@]12CCC(=O)C=C1CC[C@H]1[C@@H]3CCC(=O)[C@@]3(C)CC(=O)[C@H]21 Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 300.172545 (neutral) |
Table of KEGG reactions in human pathways involving Adrenosterone
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R04758 | 11beta-Hydroxyandrost-4-ene-3,17-dione + NADP+ <=> Adrenosterone + NADPH + H+ | 11beta-Hydroxyandrost-4-ene-3,17-dione:NADP+ 11-oxidoreductase |
Table of KEGG human pathways containing Adrenosterone
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00140 | Steroid hormone biosynthesis | 1 |