RefMet Compound Details
MW structure | 2758 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 8,9-EpETrE | |
Systematic name | 8,9-epoxy-5Z,11Z,14Z-eicosatrienoic acid | |
SMILES | CCCCC/C=C\C/C=C\CC1C(C/C=C\CCCC(=O)O)O1 Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 320.235145 (neutral) |
Table of KEGG reactions in human pathways involving 8,9-EpETrE
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R07051 | Arachidonate + Oxygen + NADPH + H+ <=> 8,9-EET + NADP+ + H2O | Arachidonate + Oxygen + NADPH + H+ <=> 8,9-EET + NADP+ + H2O |
R07110 | 8,9-EET + H2O <=> 8,9-DHET | 8,9-EET hydrolase |
Table of KEGG human pathways containing 8,9-EpETrE
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00590 | Arachidonic acid metabolism | 2 |