RefMet Compound Details
MW structure | 37967 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 7-Methylxanthine | |
Systematic name | 7-methyl-2,3,6,7-tetrahydro-1H-purine-2,6-dione | |
SMILES | Cn1cnc2[nH]c(=O)[nH]c(=O)c21 Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 166.049076 (neutral) |
Table of KEGG reactions in human pathways involving 7-Methylxanthine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R07979 | 7-Methylxanthine + Oxygen + H2O <=> 7-Methyluric acid + Hydrogen peroxide | 7-methylxanthine:oxygen oxidoreductase |
Table of KEGG human pathways containing 7-Methylxanthine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00232 | Caffeine metabolism | 1 |