RefMet Compound Details
RefMet ID | RM0135989 | |
---|---|---|
MW structure | 37412 (View MW Metabolite Database details) | |
RefMet name | 5-Hydroxyindoleacetic acid Species distribution Sample source distribution | |
Systematic name | 2-(5-hydroxy-1H-indol-3-yl)acetic acid | |
SMILES | c1cc2c(cc1O)c(CC(=O)O)c[nH]2 Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 191.058244 (neutral) |
Table of KEGG reactions in human pathways involving 5-Hydroxyindoleacetic acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R04903 | 5-Hydroxyindoleacetaldehyde + NAD+ + H2O <=> 5-Hydroxyindoleacetate + H+ + NADH | 5-Hydroxyindoleacetaldehyde:NAD+ oxidoreductase |
R04904 | 5-Hydroxyindoleacetaldehyde + Oxygen + H2O <=> 5-Hydroxyindoleacetate + Hydrogen peroxide | 5-hydroxyindoleacetaldehyde:oxygen oxidoreductase |
R04905 | S-Adenosyl-L-methionine + 5-Hydroxyindoleacetate <=> S-Adenosyl-L-homocysteine + 5-Methoxyindoleacetate | S-Adenosyl-L-methionine:N-acetylserotonin O-methyltransferase |
Table of KEGG human pathways containing 5-Hydroxyindoleacetic acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00380 | Tryptophan metabolism | 3 |