RefMet Compound Details
RefMet ID | RM0131839 | |
---|---|---|
MW structure | 43616 (View MW Metabolite Database details) | |
RefMet name | 5-Hydroxy-tryptophan Species distribution Sample source distribution | |
Systematic name | (2S)-2-amino-3-(5-hydroxy-1H-indol-3-yl)propanoic acid | |
SMILES | c1cc2c(cc1O)c(C[C@@H](C(=O)O)N)c[nH]2 Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 220.084793 (neutral) |
Table of KEGG reactions in human pathways involving 5-Hydroxy-tryptophan
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01814 | Tetrahydrobiopterin + L-Tryptophan + Oxygen <=> 5-Hydroxy-L-tryptophan + Dihydrobiopterin + H2O | L-Tryptophan,tetrahydrobiopterin:oxygen oxidoreductase (5-hydroxylating) |
R02701 | 5-Hydroxy-L-tryptophan <=> Serotonin + CO2 | 5-Hydroxy-L-tryptophan decarboxy-lyase |
R02702 | 5-Hydroxy-L-tryptophan + Oxygen <=> 5-Hydroxy-N-formylkynurenine | 5-hydroxy-L-tryptophan:oxygen 2,3-dioxygenase (indole-decyclizing) |
Table of KEGG human pathways containing 5-Hydroxy-tryptophan
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00380 | Tryptophan metabolism | 3 |