RefMet Compound Details
MW structure | 2692 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 5-HETE | |
Systematic name | 5-hydroxy-6E,8Z,11Z,14Z-eicosatetraenoic acid | |
SMILES | CCCCC/C=C\C/C=C\C/C=C\C=C\C(CCCC(=O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 320.235145 (neutral) |
Table of KEGG reactions in human pathways involving 5-HETE
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R07034 | 2 Glutathione + 5(S)-HPETE <=> Glutathione disulfide + 5(S)-HETE + H2O | Glutathione: 5-HPETE oxidoreductase |
Table of KEGG human pathways containing 5-HETE
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00590 | Arachidonic acid metabolism | 1 |