RefMet Compound Details

RefMet ID, RefMet name, exact mass and formula
RefMet IDRM0153689
RefMet name4-Aminopentanoic acid
Alternative name4-Aminobutyric acid
Systematic name4-amino-pentanoic acid
SynonymsPubChem Synonyms
Exact mass117.078979 (neutral)
Calculate m/z:   
View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC5H11NO2View other entries in RefMet with this formula
Molecular descriptors
Molfile1856 (Download molfile/View MW Metabolite Database details)
InChIInChI=1S/C5H11NO2/c1-4(6)2-3-5(7)8/h4H,2-3,6H2,1H3,(H,7,8)
InChIKeyABSTXSZPGHDTAF-UHFFFAOYSA-NView other enantiomers/diastereomers of this metabolite in RefMet
SMILESCC(CCC(=O)O)N
Run Tanimoto similarity search (with similarity coefficient >=0.6)
Chemical/Biochemical Classification
Super ClassFatty Acyls
Main ClassFatty acids
Sub ClassAmino FA
Distribution of 4-Aminopentanoic acid in NMDR studies
SpeciesPlot Species distribution
Sample sourcePlot Sample source(tissue) distribution
PlatformPlatform (MS/NMR) used for detection
ChromatographyChromatography methods used for detection
StudiesNMDR Studies reporting 4-Aminopentanoic acid
External Links
Pubchem CID223130
LIPID MAPSLMFA01100023
ChEBI ID178408
KEGG IDC00334
Structural annotation level
Annotation level2   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)

Table of KEGG reactions in human pathways involving 4-Aminopentanoic acid

Rxn IDKEGG ReactionEnzyme
R00261 L-Glutamate <=> 4-Aminobutanoate + CO2L-glutamate 1-carboxy-lyase (4-aminobutanoate-forming)
R01648 4-Aminobutanoate + 2-Oxoglutarate <=> Succinate semialdehyde + L-Glutamate4-aminobutanoate:2-oxoglutarate aminotransferase
R01986 4-Aminobutyraldehyde + NADP+ + H2O <=> 4-Aminobutanoate + NADPH + H+4-Aminobutyraldehyde:NAD+ oxidoreductase
R01989 L-Arginine + 4-Aminobutanoate <=> L-Ornithine + 4-GuanidinobutanoateL-Arginine:4-aminobutanoate amidinotransferase
R01990 4-Guanidinobutanoate + H2O <=> 4-Aminobutanoate + Urea4-Guanidinobutanoate amidinohydrolase
R01991 ATP + L-Histidine + 4-Aminobutanoate <=> ADP + Orthophosphate + HomocarnosineL-histidine:4-aminobutanoate ligase (ADP-forming)
R01992 Homocarnosine + H2O <=> 4-Aminobutanoate + L-Histidinealpha-Aminobutyryl histidine hydrolase
R02549 4-Aminobutyraldehyde + NAD+ + H2O <=> 4-Aminobutanoate + NADH + H+4-aminobutanal:NAD+ 1-oxidoreductase
R10178 4-Aminobutanoate + Pyruvate <=> Succinate semialdehyde + L-Alanine4-aminobutanoate:pyruvate aminotransferase

Table of KEGG human pathways containing 4-Aminopentanoic acid

Pathway IDHuman Pathway# of reactions
hsa00330 Arginine and proline metabolism 5
hsa01100 Metabolic pathways 4
hsa00250 Alanine, aspartate and glutamate metabolism 2
hsa00650 Butanoate metabolism 2
  logo