RefMet Compound Details
MW structure | 51044 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 3-Phosphoglyceric acid | |
Systematic name | (2R)-2-hydroxy-3-(phosphonooxy)propanoic acid | |
SMILES | C([C@H](C(=O)O)O)OP(=O)(O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 185.992943 (neutral) |
Table of KEGG reactions in human pathways involving 3-Phosphoglyceric acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01513 | 3-Phospho-D-glycerate + NAD+ <=> 3-Phosphonooxypyruvate + NADH + H+ | 3-Phospho-D-glycerate:NAD+ 2-oxidoreductase |
R01512 | ATP + 3-Phospho-D-glycerate <=> ADP + 3-Phospho-D-glyceroyl phosphate | ATP:3-phospho-D-glycerate 1-phosphotransferase |
R01516 | 2,3-Bisphospho-D-glycerate + Protein histidine <=> 3-Phospho-D-glycerate + Protein N(tau)-phospho-L-histidine | 2,3-bisphospho-D-glycerate 2-phosphohydrolase |
R01518 | 2-Phospho-D-glycerate <=> 3-Phospho-D-glycerate | D-phosphoglycerate 2,3-phosphomutase |
Table of KEGG human pathways containing 3-Phosphoglyceric acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00010 | Glycolysis / Gluconeogenesis | 3 |
hsa01200 | Carbon metabolism | 3 |
hsa01230 | Biosynthesis of amino acids | 3 |
hsa00260 | Glycine, serine and threonine metabolism | 2 |
hsa00270 | Cysteine and methionine metabolism | 1 |