RefMet Compound Details
MW structure | 53577 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 3-Hydroxy-3-methylglutaryl-CoA | |
Alternative name | CoA DC(5:0;3OH,3Me | |
Systematic name | 3'-phosphoadenosine 5'-{3-[(3R)-4-{[3-({2-[(4-carboxy-3-hydroxy-3-methylbutanoyl)sulfanyl]ethyl}amino)-3-oxopropyl]amino}-3-hydroxy-2,2-dimethyl-4-oxobutyl] dihydrogen diphosphate} | |
SMILES | CC(O)(CC(=O)O)CC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 911.157479 (neutral) |
Table of KEGG reactions in human pathways involving 3-Hydroxy-3-methylglutaryl-CoA
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02085 | (S)-3-Hydroxy-3-methylglutaryl-CoA <=> 3-Methylglutaconyl-CoA + H2O | (S)-3-Hydroxy-3-methylglutaryl-CoA hydro-lyase (trans-3-methylglutaconyl-CoA-forming) |
R01360 | (S)-3-Hydroxy-3-methylglutaryl-CoA <=> Acetyl-CoA + Acetoacetate | (S)-3-hydroxy-3-methylglutaryl-CoA acetoacetate-lyase (acetyl-CoA-forming) |
R01978 | (S)-3-Hydroxy-3-methylglutaryl-CoA + CoA <=> Acetyl-CoA + H2O + Acetoacetyl-CoA | acetyl-CoA:acetoacetyl-CoA C-acetyltransferase (thioester-hydrolysing, carboxymethyl-forming) |
R02082 | (R)-Mevalonate + CoA + 2 NADP+ <=> (S)-3-Hydroxy-3-methylglutaryl-CoA + 2 NADPH + 2 H+ | (R)-Mevalonate:NADP+ oxidoreductase (CoA acylating) |
Table of KEGG human pathways containing 3-Hydroxy-3-methylglutaryl-CoA
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00280 | Valine, leucine and isoleucine degradation | 3 |
hsa00072 | Synthesis and degradation of ketone bodies | 2 |
hsa00650 | Butanoate metabolism | 2 |
hsa00900 | Terpenoid backbone biosynthesis | 2 |