RefMet Compound Details
RefMet ID | RM0135874 | |
---|---|---|
MW structure | 37050 (View MW Metabolite Database details) | |
RefMet name | 3',5' cyclic AMP Species distribution Sample source distribution | |
Systematic name | (4aR,6R,7R,7aS)-6-(6-amino-9H-purin-9-yl)-2,7-dihydroxy-hexahydro-1,3,5,2$l^{5}-furo[3,2-d][1,3,2$l^{5}]dioxaphosphinin-2-one | |
SMILES | C1[C@@H]2[C@H]([C@H]([C@H](n3cnc4c(N)ncnc34)O2)O)OP(=O)(O)O1 Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 329.052523 (neutral) |
Table of KEGG reactions in human pathways involving 3',5' cyclic AMP
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00089 | ATP <=> 3',5'-Cyclic AMP + Diphosphate | ATP diphosphate-lyase (cyclizing |
R00191 | 3',5'-Cyclic AMP + H2O <=> AMP | adenosine 3',5'-phosphate 5'-nucleotidohydrolase |
Table of KEGG human pathways containing 3',5' cyclic AMP
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00230 | Purine metabolism | 2 |