RefMet Compound Details
RefMet ID | RM0135645 | |
---|---|---|
MW structure | 34378 (View MW Metabolite Database details) | |
RefMet name | 25-Hydroxycholesterol Species distribution Sample source distribution | |
Systematic name | cholest-5-en-3beta,25-diol | |
SMILES | C[C@H](CCCC(C)(C)O)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 27:1;O2 | View other entries in RefMet with this sum composition |
Exact mass | 402.349780 (neutral) |
Table of KEGG reactions in human pathways involving 25-Hydroxycholesterol
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R07209 | 25-Hydroxycholesterol + [Reduced NADPH---hemoprotein reductase] + Oxygen <=> Cholest-5-ene-3beta,7alpha,25-triol + [Oxidized NADPH---hemoprotein reductase] + H2O | cholest-5-ene-3beta,25-diol,[NADPH---hemoprotein reductase]:oxygen oxidoreductase (7alpha-hydroxylating) |
R07218 | Cholesterol + Reduced acceptor + Oxygen <=> 25-Hydroxycholesterol + Acceptor + H2O | cholesterol,hydrogen-donor:oxygen oxidoreductase (25-hydroxylating) |
Table of KEGG human pathways containing 25-Hydroxycholesterol
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00120 | Primary bile acid biosynthesis | 2 |