RefMet Compound Details
RefMet ID | RM0139512 | |
---|---|---|
MW structure | 2635 (View MW Metabolite Database details) | |
RefMet name | 20-HETE | |
Systematic name | 20-hydroxy-5Z,8Z,11Z,14Z-eicosatetraenoic acid | |
SMILES | C(=C\C/C=C\CCCCCO)\C/C=C\C/C=C\CCCC(=O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 320.235145 (neutral) |
Table of KEGG reactions in human pathways involving 20-HETE
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R07041 | Arachidonate + [Reduced NADPH---hemoprotein reductase] + Oxygen <=> 20-HETE + [Oxidized NADPH---hemoprotein reductase] + H2O | Arachidonic acid:oxygen 1-oxidoreductase |
Table of KEGG human pathways containing 20-HETE
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00590 | Arachidonic acid metabolism | 1 |