RefMet Compound Details
MW structure | 36908 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 2-Methoxyestrone 3-glucuronide | |
Systematic name | 2-methoxy,3-hydroxy-estra-1,3,5(10)-trien-17-one 3-D-glucuronide | |
SMILES | C[C@]12CC[C@H]3[C@@H](CCc4cc(c(cc34)OC)O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](C(=O)O)O3)O)O)O)[C@@H]1CCC2=O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 19:4;O3;GlcA | View other entries in RefMet with this sum composition |
Exact mass | 476.204635 (neutral) |
Table of KEGG reactions in human pathways involving 2-Methoxyestrone 3-glucuronide
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R04353 | 2-Methoxyestrone + UDP-glucuronate <=> 2-Methoxyestrone 3-glucuronide + UDP | UDPglucuronate beta-D-glucuronosyltransferase(acceptor-unspecific) |
Table of KEGG human pathways containing 2-Methoxyestrone 3-glucuronide
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00140 | Steroid hormone biosynthesis | 1 |