RefMet Compound Details
MW structure | 37710 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 2,3-Diphosphoglyceric acid | |
Systematic name | (2R)-2,3-bis(phosphonooxy)propanoic acid | |
SMILES | OP(O)(=O)OC[C@@H](OP(O)(O)=O)C(O)=O | |
Exact mass | 265.959276 (neutral) |
Table of KEGG reactions in human pathways involving 2,3-Diphosphoglyceric acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01516 | 2,3-Bisphospho-D-glycerate + Protein histidine <=> 3-Phospho-D-glycerate + Protein N(tau)-phospho-L-histidine | 2,3-bisphospho-D-glycerate 2-phosphohydrolase |
R01662 | 3-Phospho-D-glyceroyl phosphate <=> 2,3-Bisphospho-D-glycerate | 3-phospho-D-glycerate 1,2-phosphomutase |
R09532 | 2,3-Bisphospho-D-glycerate + H2O <=> 2-Phospho-D-glycerate + Orthophosphate | 2,3-bisphospho-D-glycerate 3-phosphohydrolase |
Table of KEGG human pathways containing 2,3-Diphosphoglyceric acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00010 | Glycolysis / Gluconeogenesis | 3 |