RefMet Compound Details
RefMet ID | RM0152260 | |
---|---|---|
MW structure | 2640 (View MW Metabolite Database details) | |
RefMet name | 15S-HpETE | |
Systematic name | 15S-hydroperoxy-5Z,8Z,11Z,13E-eicosatetraenoic acid | |
SMILES | CCCCC[C@@H](/C=C/C=C\C/C=C\C/C=C\CCCC(=O)O)OO Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 336.230060 (neutral) |
Table of KEGG reactions in human pathways involving 15S-HpETE
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01593 | Arachidonate + Oxygen <=> 15(S)-HPETE | arachidonate:oxygen 15-oxidoreductase |
R07035 | 2 Glutathione + 15(S)-HPETE <=> Glutathione disulfide + (15S)-15-Hydroxy-5,8,11-cis-13-trans-eicosatetraenoate + H2O | Glutathione: 15-HPETE oxidoreductase |
R07042 | 15(S)-HPETE <=> 15H-11,12-EETA | 15(S)-HPETE <=> 15H-11,12-EETA |
R07043 | 15(S)-HPETE <=> 11H-14,15-EETA | 15(S)-HPETE <=> 11H-14,15-EETA |
Table of KEGG human pathways containing 15S-HpETE
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00590 | Arachidonic acid metabolism | 4 |