RefMet Compound Details
MW structure | 35347 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 11beta-Hydroxyandrost-4-ene-3,17-dione | |
Systematic name | 11beta-hydroxyandrost-4-ene-3,17-dione | |
SMILES | C[C@]12CCC(=O)C=C1CC[C@H]1[C@@H]3CCC(=O)[C@@]3(C)C[C@@H]([C@H]21)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 19:3;O3 | View other entries in RefMet with this sum composition |
Exact mass | 302.188195 (neutral) |
Table of KEGG reactions in human pathways involving 11beta-Hydroxyandrost-4-ene-3,17-dione
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02725 | 2 Reduced adrenal ferredoxin + Androstenedione + Oxygen + 2 H+ <=> 11beta-Hydroxyandrost-4-ene-3,17-dione + 2 Oxidized adrenal ferredoxin + H2O | Androstenedione,reduced-adrenal-ferredoxin:oxygen oxidoreductase (11-hydroxylating) |
R04758 | 11beta-Hydroxyandrost-4-ene-3,17-dione + NADP+ <=> Adrenosterone + NADPH + H+ | 11beta-Hydroxyandrost-4-ene-3,17-dione:NADP+ 11-oxidoreductase |
R08945 | 11beta,17beta-Dihydroxy-4-androsten-3-one + NAD+ <=> 11beta-Hydroxyandrost-4-ene-3,17-dione + NADH + H+ | 11beta,17beta-dihydroxy-4-androsten-3-one:NAD+ 17-oxidoreductase |
R08980 | 11beta,17beta-Dihydroxy-4-androsten-3-one + NADP+ <=> 11beta-Hydroxyandrost-4-ene-3,17-dione + NADPH + H+ | 11beta,17beta-dihydroxy-4-androsten-3-one:NADP+ 17-oxidoreductase |
Table of KEGG human pathways containing 11beta-Hydroxyandrost-4-ene-3,17-dione
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00140 | Steroid hormone biosynthesis | 4 |