RefMet Compound Details
MW structure | 35391 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 11-Deoxycorticosterone | |
Systematic name | 21-hydroxypregn-4-ene-3,20-dione | |
SMILES | C[C@]12CCC(=O)C=C1CC[C@H]1[C@@H]3CC[C@H](C(=O)CO)[C@@]3(C)CC[C@H]21 Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 21:3;O3 | View other entries in RefMet with this sum composition |
Exact mass | 330.219495 (neutral) |
Table of KEGG reactions in human pathways involving 11-Deoxycorticosterone
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02213 | Progesterone + [Reduced NADPH---hemoprotein reductase] + Oxygen <=> 11-Deoxycorticosterone + [Oxidized NADPH---hemoprotein reductase] + H2O | progesterone,NADPH-hemoprotein reductase:oxygen oxidoreductase (21-hydroxylating) |
R03851 | 11-Deoxycorticosterone + 2 Reduced ferredoxin + Oxygen + 2 H+ <=> Corticosterone + 2 Oxidized ferredoxin + H2O | 11-deoxycorticosterone,reduced ferredoxin:oxygen oxidoreductase (11-hydroxylating) |
R04163 | 21-Hydroxypregnenolone + NAD+ <=> 11-Deoxycorticosterone + NADH + H+ | 21-Hydroxypregnenolone:NAD+ 3-oxidoreductase |
R08954 | 11-Deoxycorticosterone + NADPH + H+ <=> 5alpha-Dihydrodeoxycorticosterone + NADP+ | 5alpha-dihydrodeoxycorticosterone:NADP+ delta4-oxidoreductase |
Table of KEGG human pathways containing 11-Deoxycorticosterone
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00140 | Steroid hormone biosynthesis | 4 |