RefMet Compound Details

RefMet ID, RefMet name, exact mass and formula
RefMet IDRM0136343
RefMet name1-Methylxanthine
Systematic name1-methyl-2,3,6,7-tetrahydro-1H-purine-2,6-dione
SynonymsPubChem Synonyms
Exact mass166.049076 (neutral)
Calculate m/z:   
View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC6H6N4O2View other entries in RefMet with this formula
Molecular descriptors
Molfile41117 (Download molfile/View MW Metabolite Database details)
InChIInChI=1S/C6H6N4O2/c1-10-5(11)3-4(8-2-7-3)9-6(10)12/h2H,1H3,(H,7,8)(H,9,12)
InChIKeyMVOYJPOZRLFTCP-UHFFFAOYSA-NView other enantiomers/diastereomers of this metabolite in RefMet
SMILESCn1c(=O)c2c(nc[nH]2)[nH]c1=O
Run Tanimoto similarity search (with similarity coefficient >=0.6)
Chemical/Biochemical Classification
Super ClassNucleic acids
Main ClassPurines
Sub ClassXanthines
Distribution of 1-Methylxanthine in NMDR studies
SpeciesPlot Species distribution
Sample sourcePlot Sample source(tissue) distribution
PlatformPlatform (MS/NMR) used for detection
ChromatographyChromatography methods used for detection
StudiesNMDR Studies reporting 1-Methylxanthine
External Links
Pubchem CID80220
ChEBI ID68444
KEGG IDC16358
HMDB IDHMDB0010738
Chemspider ID72464
MetaCyc IDCPD-9025
EPA CompToxDTXCID30132762
PhytoHub DBPHUB002340
Spectral data for 1-Methylxanthine standards
MassBank(EU)View MS spectra
Structural annotation level
Annotation level1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)

Table of KEGG reactions in human pathways involving 1-Methylxanthine

Rxn IDKEGG ReactionEnzyme
R07942 1-Methylxanthine + H2O + Oxygen <=> 1-Methyluric acid + Hydrogen peroxide1-methylxanthine:oxygen oxidoreductase
R07943 1,7-Dimethylxanthine <=> 1-Methylxanthine1,7-Dimethylxanthine <=> 1-Methylxanthine
R07959 1,7-Dimethylxanthine + NADH + H+ + Oxygen <=> 1-Methylxanthine + NAD+ + Formaldehyde + H2O1,7-Dimethylxanthine + NADH + H+ + Oxygen <=> 1-Methylxanthine + NAD+ + Formaldehyde + H2O
R07960 1,7-Dimethylxanthine + NADPH + H+ + Oxygen <=> 1-Methylxanthine + NADP+ + Formaldehyde + H2O1,7-Dimethylxanthine + NADPH + H+ + Oxygen <=> 1-Methylxanthine + NADP+ + Formaldehyde + H2O

Table of KEGG human pathways containing 1-Methylxanthine

Pathway IDHuman Pathway# of reactions
hsa00232 Caffeine metabolism 2
hsa01100 Metabolic pathways 2
  logo